CymitQuimica logo

CAS 7508-13-6

:

5-(3,4-dimethylphenyl)-5-oxopentanoic acid

Description:
5-(3,4-Dimethylphenyl)-5-oxopentanoic acid, with the CAS number 7508-13-6, is an organic compound characterized by its structure, which includes a pentanoic acid backbone substituted with a 3,4-dimethylphenyl group and a ketone functional group. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic ring. The presence of both a carboxylic acid and a ketone functional group suggests it may exhibit acidic properties and participate in various chemical reactions, such as esterification or condensation. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Additionally, the presence of the dimethylphenyl group may influence its biological activity and interaction with other molecules. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C13H16O3
InChI:InChI=1/C13H16O3/c1-9-6-7-11(8-10(9)2)12(14)4-3-5-13(15)16/h6-8H,3-5H2,1-2H3,(H,15,16)
SMILES:Cc1ccc(cc1C)C(=O)CCCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.