CymitQuimica logo

CAS 7508-76-1

:

quinoline-2,8-diamine

Description:
Quinoline-2,8-diamine, also known as 2,8-diaminoquinoline, is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom in the heterocyclic ring. This compound features two amino groups (-NH2) located at the 2 and 8 positions of the quinoline ring, contributing to its reactivity and potential applications in various fields. Quinoline-2,8-diamine is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino groups. It is known for its biological activity, including potential use in pharmaceuticals and as a precursor in the synthesis of other chemical compounds. The presence of the amino groups allows for various chemical modifications, making it a versatile building block in organic synthesis. Additionally, quinoline derivatives are often studied for their antimicrobial and antitumor properties, highlighting the importance of quinoline-2,8-diamine in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5H,10H2,(H2,11,12)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.