CAS 7508-99-8

1-(3-Fluorophenyl)-1H-pyrrole-2,5-dione

Description:

1-(3-Fluorophenyl)-1H-pyrrole-2,5-dione, with the CAS number 7508-99-8, is an organic compound characterized by its unique structure, which includes a pyrrole ring substituted with a fluorophenyl group. This compound typically exhibits a yellow to orange color and is known for its potential applications in pharmaceuticals and organic synthesis due to its reactive carbonyl groups. The presence of the fluorine atom enhances its electronic properties, potentially influencing its reactivity and biological activity. As a diketone, it can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The compound's solubility may vary depending on the solvent, but it is generally soluble in organic solvents. Its stability can be affected by environmental factors such as light and moisture, necessitating careful handling and storage. Overall, 1-(3-Fluorophenyl)-1H-pyrrole-2,5-dione is of interest in both research and industrial applications, particularly in the development of new materials and therapeutic agents.

Formula: C₁₀H₆FNO₂

InChI: InChI=1/C10H6FNO2/c11-7-2-1-3-8(6-7)12-9(13)4-5-10(12)14/h1-6H

SMILES: c1cc(cc(c1)N1C(=O)C=CC1=O)F

Synonyms:

• 1H-Pyrrole-2,5-dione, 1-(3-fluorophenyl)-

N-(3-Fluoro-phenyl)maleimide

CAS: 7508-99-8

N-(3-Fluoro-phenyl)maleimide

Purity: ≥95%

Molecular weight: 191.16g/mol

Ref: 54-PC11120