CAS 75082-88-1
:beta-hydroxy-3-nitrophenylalanine
Description:
Beta-hydroxy-3-nitrophenylalanine, with the CAS number 75082-88-1, is an amino acid derivative characterized by the presence of a hydroxyl group and a nitro group on the phenylalanine structure. This compound features a beta-hydroxy group, which contributes to its solubility and reactivity, making it a valuable intermediate in organic synthesis and pharmaceutical applications. The nitro group, located at the meta position relative to the amino acid's carboxyl group, can influence the compound's electronic properties and reactivity, potentially affecting its biological activity. Beta-hydroxy-3-nitrophenylalanine may exhibit unique interactions in biochemical pathways, particularly in enzyme catalysis or as a building block for more complex molecules. Its structural characteristics allow for potential applications in medicinal chemistry, where modifications can lead to compounds with enhanced therapeutic properties. As with many nitro-substituted compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental impact.
Formula:C9H10N2O5
InChI:InChI=1/C9H10N2O5/c10-7(9(13)14)8(12)5-2-1-3-6(4-5)11(15)16/h1-4,7-8,12H,10H2,(H,13,14)
SMILES:c1cc(cc(c1)N(=O)=O)C(C(C(=O)O)N)O
Synonyms:- Phenylalanine, Beta-Hydroxy-3-Nitro-
- beta-Hydroxy-3-nitrophenylalanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.