CymitQuimica logo

CAS 7509-61-7

:

N-(2-ethylphenyl)-2-(hydroxyimino)acetamide

Description:
N-(2-ethylphenyl)-2-(hydroxyimino)acetamide, with the CAS number 7509-61-7, is an organic compound characterized by its amide functional group and a hydroxyimino moiety. This compound features a phenyl ring substituted with an ethyl group, contributing to its hydrophobic characteristics. The presence of the hydroxyimino group introduces both polar and hydrogen-bonding capabilities, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active ingredients in various applications. The structural configuration allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-(2-ethylphenyl)-2-(hydroxyimino)acetamide represents a class of compounds that may have diverse applications in chemical research and development.
Formula:C10H12N2O2
InChI:InChI=1/C10H12N2O2/c1-2-8-5-3-4-6-9(8)12-10(13)7-11-14/h3-7,14H,2H2,1H3,(H,12,13)
SMILES:CCc1ccccc1NC(=O)C=NO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.