CAS 7509-65-1

3-(5-methyl-1,3-benzoxazol-2-yl)aniline

Description:

3-(5-Methyl-1,3-benzoxazol-2-yl)aniline, with the CAS number 7509-65-1, is an organic compound characterized by its structure, which includes a benzene ring, an aniline group, and a benzoxazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in the fields of dyes, pigments, or pharmaceuticals due to its aromatic nature. The presence of the methyl group on the benzoxazole ring can influence its solubility and reactivity, making it a subject of interest in various chemical syntheses. Additionally, the compound may display specific optical properties, which can be utilized in fluorescence or as a chromophore in materials science. Its synthesis often involves the coupling of an aniline derivative with a benzoxazole precursor, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₄H₁₂N₂O

InChI: InChI=1/C14H12N2O/c1-9-5-6-13-12(7-9)16-14(17-13)10-3-2-4-11(15)8-10/h2-8H,15H2,1H3

SMILES: Cc1ccc2c(c1)nc(c1cccc(c1)N)o2

Synonyms:

• Benzenamine, 3-(5-Methyl-2-Benzoxazolyl)-