CAS 7509-73-1
:3,5-diamino-N-[7-(diethylamino)-4-methyl-2-oxo-2H-chromen-6-yl]benzamide
Description:
3,5-Diamino-N-[7-(diethylamino)-4-methyl-2-oxo-2H-chromen-6-yl]benzamide, with the CAS number 7509-73-1, is a synthetic organic compound characterized by its complex structure, which includes a benzamide moiety and a chromenone derivative. This compound features multiple amino groups, which contribute to its potential as a ligand in coordination chemistry or as a precursor in pharmaceutical applications. The presence of the diethylamino group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The chromenone structure is known for its biological activity, including antioxidant and anti-inflammatory properties. The compound's molecular interactions may be influenced by its functional groups, allowing for diverse applications in medicinal chemistry, particularly in drug design and development. Its stability and reactivity can be affected by environmental conditions such as pH and temperature, which are critical factors to consider in practical applications. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in organic chemistry.
Formula:C21H24N4O3
InChI:InChI=1/C21H24N4O3/c1-4-25(5-2)18-11-19-16(12(3)6-20(26)28-19)10-17(18)24-21(27)13-7-14(22)9-15(23)8-13/h6-11H,4-5,22-23H2,1-3H3,(H,24,27)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
