CAS 75090-52-7: 7-Bromo-4-chloroquinoline

Description:7-Bromo-4-chloroquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of bromine and chlorine substituents at the 7 and 4 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit antimicrobial, antimalarial, or anticancer properties, making it of interest in drug discovery. The presence of halogens can influence the compound's solubility, stability, and interaction with biological targets. Additionally, 7-Bromo-4-chloroquinoline can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which are common in the chemistry of halogenated compounds. Safety data should be consulted when handling this substance, as halogenated compounds can pose health risks.

Formula:C₉H₅BrClN

InChI:InChI=1/C9H5BrClN/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H

Found 3 products.

Product data	Purity	Price range	Estimated delivery
7-Bromo-4-chloroquinoline REF: 54-OR43544CAS: 75090-52-7	96%	37.00 €~873.00 €	Wed 13 Aug 25
7-Bromo-4-chloroquinoline REF: 10-F076401CAS: 75090-52-7	97.0%	To inquire	Fri 22 Aug 25
7-Bromo-4-chloroquinoline REF: 3D-FB42364CAS: 75090-52-7	Min. 95%	- - -	Discontinued product