CymitQuimica logo

CAS 75095-81-7

:

1-(2-Methylphenyl)cyclopentanamine

Description:
1-(2-Methylphenyl)cyclopentanamine, with the CAS number 75095-81-7, is an organic compound characterized by its cyclopentane ring structure substituted with a 2-methylphenyl group and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the cyclopentane ring contributes to its three-dimensional conformation, potentially affecting its reactivity and interactions with biological systems. Additionally, the methyl group on the phenyl ring can influence the compound's electronic properties and steric hindrance, which may affect its pharmacological activity. As with many amines, it may have a distinct odor and can participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, the unique structure of 1-(2-Methylphenyl)cyclopentanamine makes it of interest in both synthetic chemistry and potential applications in pharmaceuticals.
Formula:C12H17N
InChI:InChI=1S/C12H17N/c1-10-6-2-3-7-11(10)12(13)8-4-5-9-12/h2-3,6-7H,4-5,8-9,13H2,1H3
InChI key:InChIKey=PKYMSRQFIIFDJY-UHFFFAOYSA-N
SMILES:NC1(CCCC1)C2=C(C)C=CC=C2
Synonyms:
  • 1-(2-Methylphenyl)cyclopentan-1-amine
  • Cyclopentanamine, 1-(2-methylphenyl)-
  • 1-(2-Methylphenyl)cyclopentanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.