CymitQuimica logo

CAS 7510-04-5

:

cholesterylaniline

Description:
Cholesterylaniline is an organic compound that combines a cholesterol moiety with an aniline group, resulting in a molecule that exhibits both hydrophobic and hydrophilic characteristics. This amphiphilic nature allows cholesterylaniline to interact with lipid membranes and proteins, making it of interest in biochemistry and materials science. The compound is typically characterized by its molecular structure, which includes a steroidal backbone derived from cholesterol and an amino group from aniline, contributing to its potential applications in drug delivery systems and as a surfactant. Cholesterylaniline may also exhibit unique optical properties due to the presence of the aromatic aniline group. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions, including those typical of amines and alcohols. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, cholesterylaniline serves as a valuable compound in research and industrial applications due to its distinctive structural features and functional properties.
Formula:C33H51N
InChI:InChI=1/C33H51N/c1-23(2)10-9-11-24(3)29-16-17-30-28-15-14-25-22-27(34-26-12-7-6-8-13-26)18-20-32(25,4)31(28)19-21-33(29,30)5/h6-8,12-14,23-24,27-31,34H,9-11,15-22H2,1-5H3
SMILES:CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)Nc1ccccc1
Synonyms:
  • N-phenylcholest-5-en-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.