
CAS 7510-15-8
:5-Methoxy-1-methyl-1H-indole-3-acetic acid
Description:
5-Methoxy-1-methyl-1H-indole-3-acetic acid, with the CAS number 7510-15-8, is a chemical compound that belongs to the class of indole derivatives. This substance features a methoxy group and a methyl group attached to the indole ring, contributing to its unique properties. It is known for its potential biological activities, particularly in the field of plant growth regulation, where it may act as a phytohormone. The compound exhibits characteristics typical of indole derivatives, such as a planar structure that allows for π-π stacking interactions, which can influence its reactivity and interactions with biological targets. Additionally, its solubility and stability can vary depending on the pH and solvent conditions. Research into this compound may focus on its role in plant physiology, potential therapeutic applications, and its mechanisms of action at the molecular level. Overall, 5-Methoxy-1-methyl-1H-indole-3-acetic acid represents a significant area of interest in both synthetic and applied chemistry.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c1-13-7-8(5-12(14)15)10-6-9(16-2)3-4-11(10)13/h3-4,6-7H,5H2,1-2H3,(H,14,15)
InChI key:InChIKey=MRLXXUFKUMSMBU-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1C=2C(N(C)C1)=CC=C(OC)C2
Synonyms:- 5-Methoxy-1-methyl-3-indolylacetic acid
- 5-Methoxy-1-methyl-1H-indole-3-acetic acid
- Indole-3-acetic acid, 5-methoxy-1-methyl-
- 1H-Indole-3-acetic acid, 5-methoxy-1-methyl-
- NSC 405601
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.