
CAS 7510-46-5
:{2-methoxy-4-[(1E)-prop-1-en-1-yl]phenoxy}acetate
Description:
The chemical substance known as {2-methoxy-4-[(1E)-prop-1-en-1-yl]phenoxy}acetate, with the CAS number 7510-46-5, is an organic compound characterized by its phenoxyacetate structure. It features a methoxy group and a propenyl substituent, which contribute to its reactivity and potential applications in various chemical processes. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents. Its molecular structure suggests it may possess interesting biological activities, making it a candidate for research in fields such as agrochemicals or pharmaceuticals. The presence of the methoxy group can enhance lipophilicity, while the propenyl moiety may allow for further chemical modifications. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, {2-methoxy-4-[(1E)-prop-1-en-1-yl]phenoxy}acetate is a versatile compound with potential utility in various applications, warranting further investigation into its properties and uses.
Formula:C12H13O4
InChI:InChI=1/C12H14O4/c1-3-4-9-5-6-10(11(7-9)15-2)16-8-12(13)14/h3-7H,8H2,1-2H3,(H,13,14)/p-1/b4-3+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.