CAS 7510-65-8

ethyl (2Z)-3-[(2-chlorophenyl)amino]-2-cyanoprop-2-enoate

Description:

Ethyl (2Z)-3-[(2-chlorophenyl)amino]-2-cyanoprop-2-enoate, with the CAS number 7510-65-8, is an organic compound characterized by its unique structural features. It contains an ethyl ester functional group, a cyano group, and an amino group attached to a prop-2-enoate backbone, which contributes to its reactivity and potential biological activity. The presence of the 2-chlorophenyl group suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. This compound is typically a solid or liquid at room temperature, depending on its purity and specific formulation. Its chemical properties include solubility in organic solvents and potential reactivity with nucleophiles due to the presence of the cyano and amino groups. Ethyl (2Z)-3-[(2-chlorophenyl)amino]-2-cyanoprop-2-enoate may also exhibit specific optical activity due to its stereochemistry, which can influence its biological interactions. Overall, this compound's unique structure and functional groups make it a candidate for further research in various chemical and pharmaceutical applications.

Formula: C₁₂H₁₁ClN₂O₂

InChI: InChI=1/C12H11ClN2O2/c1-2-17-12(16)9(7-14)8-15-11-6-4-3-5-10(11)13/h3-6,8,15H,2H2,1H3/b9-8-

SMILES: CCOC(=O)/C(=C\Nc1ccccc1Cl)/C#N

Synonyms:

• 2-propenoic acid, 3-[(2-chlorophenyl)amino]-2-cyano-, ethyl ester, (2Z)-
• Ethyl (2Z)-3-[(2-chlorophenyl)amino]-2-cyanoacrylate