CAS 75102-19-1
:9,10-dimethoxy-1,2,3,4-tetrahydro-1,4-methanoanthracene
Description:
9,10-Dimethoxy-1,2,3,4-tetrahydro-1,4-methanoanthracene, with CAS number 75102-19-1, is an organic compound characterized by its complex polycyclic structure, which includes a fused ring system typical of anthracene derivatives. This compound features two methoxy (-OCH₃) groups attached to the 9 and 10 positions of the anthracene framework, contributing to its chemical reactivity and potential applications in organic synthesis and materials science. The tetrahydro configuration indicates that it has four hydrogen atoms added to the anthracene structure, resulting in a saturated form that may exhibit different physical and chemical properties compared to its unsaturated counterparts. Typically, such compounds can display interesting optical properties, making them candidates for use in organic light-emitting diodes (OLEDs) and other electronic applications. Additionally, the presence of methoxy groups can influence solubility and polarity, affecting how the compound interacts with various solvents and reagents. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic and applied chemistry.
Formula:C17H18O2
InChI:InChI=1/C17H18O2/c1-18-16-12-5-3-4-6-13(12)17(19-2)15-11-8-7-10(9-11)14(15)16/h3-6,10-11H,7-9H2,1-2H3
Synonyms:- 3,10-Dimethoxytetracyclo[10.2.1.0~2,11~.0~4,9~]pentadeca-2,4(9),5,7,10-pentaene
- 1,4-methanoanthracene, 1,2,3,4-tetrahydro-9,10-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
