CAS 7511-14-0
:N,N-dimethyl-1H-indole-2-carboxamide
Description:
N,N-Dimethyl-1H-indole-2-carboxamide, with the CAS number 7511-14-0, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a carboxamide functional group, which contributes to its polar nature and potential solubility in polar solvents. The presence of two methyl groups attached to the nitrogen atom of the amide enhances its lipophilicity, influencing its biological activity and interaction with various biological systems. N,N-Dimethyl-1H-indole-2-carboxamide is often studied for its pharmacological properties, including potential applications in medicinal chemistry. Its structural features may allow it to interact with specific receptors or enzymes, making it of interest in drug development. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.
Formula:C11H12N2O
InChI:InChI=1/C11H12N2O/c1-13(2)11(14)10-7-8-5-3-4-6-9(8)12-10/h3-7,12H,1-2H3
SMILES:CN(C)C(=O)c1cc2ccccc2[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N’,N’-Dimethylindole-2-carboxamide
CAS:Controlled ProductApplications N’,N’-Dimethylindole-2-carboxamide (cas# 7511-14-0) is a compound useful in organic synthesis.
Formula:C11H12N2OColor and Shape:NeatMolecular weight:188.23
