CAS 7511-43-5
:2-methyl-2,3-diphenylpropanoic acid
Description:
2-Methyl-2,3-diphenylpropanoic acid, with the CAS number 7511-43-5, is an organic compound characterized by its unique structure, which includes a propanoic acid backbone substituted with two phenyl groups and a methyl group. This compound typically appears as a white to off-white crystalline solid. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and acetone. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the bulky diphenyl substituents contribute to its steric hindrance, which can influence its reactivity and interactions with other molecules. This compound is of interest in organic synthesis and may have applications in pharmaceuticals or as a building block in the development of more complex chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-16(15(17)18,14-10-6-3-7-11-14)12-13-8-4-2-5-9-13/h2-11H,12H2,1H3,(H,17,18)
SMILES:CC(Cc1ccccc1)(c1ccccc1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.