CymitQuimica logo

CAS 7511-49-1

:

1,3,5-Tris(4-bromophenyl)benzene

Description:
1,3,5-Tris(4-bromophenyl)benzene is an organic compound characterized by its symmetrical structure, featuring a central benzene ring with three 4-bromophenyl substituents. This compound belongs to the class of polybrominated aromatic hydrocarbons, which are known for their potential applications in materials science, particularly in the development of organic light-emitting diodes (OLEDs) and as intermediates in organic synthesis. The presence of bromine atoms enhances its electronic properties and can influence its reactivity and solubility. Typically, this compound exhibits good thermal stability and can be synthesized through various methods, including bromination of phenyl derivatives. Its molecular structure contributes to its potential as a building block in supramolecular chemistry and in the design of functional materials. However, due to the presence of bromine, it is essential to consider environmental and health implications, as brominated compounds can pose risks if not handled properly. Overall, 1,3,5-Tris(4-bromophenyl)benzene is a significant compound in the field of organic chemistry with various potential applications.
Formula:C24H15Br3
InChI:InChI=1/C24H15Br3/c25-22-7-1-16(2-8-22)19-13-20(17-3-9-23(26)10-4-17)15-21(14-19)18-5-11-24(27)12-6-18/h1-15H
InChI key:HJQRITCAXSBOPC-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1cc(cc(c1)c1ccc(cc1)Br)c1ccc(cc1)Br)Br
Found 6 products.