CAS 7511-62-8
:3-[(methylsulfonyl)oxy]-2,2-bis{[(methylsulfonyl)oxy]methyl}propyl methanesulfonate
Description:
3-[(Methylsulfonyl)oxy]-2,2-bis{[(methylsulfonyl)oxy]methyl}propyl methanesulfonate, with CAS number 7511-62-8, is a chemical compound characterized by its complex structure featuring multiple methylsulfonyl groups. This compound is typically a white to off-white solid, soluble in polar solvents due to the presence of sulfonate groups, which enhance its hydrophilicity. It is often used in organic synthesis and as a reagent in various chemical reactions, particularly in the field of medicinal chemistry. The presence of methylsulfonyl groups contributes to its stability and reactivity, making it useful in the formation of sulfonate esters. Additionally, this compound may exhibit biological activity, although specific pharmacological properties would depend on its application and context. Safety data should be consulted for handling and usage, as sulfonate compounds can have varying degrees of toxicity and environmental impact. Overall, its unique structure and functional groups make it a valuable compound in both research and industrial applications.
Formula:C9H20O12S4
InChI:InChI=1/C9H20O12S4/c1-22(10,11)18-5-9(6-19-23(2,12)13,7-20-24(3,14)15)8-21-25(4,16)17/h5-8H2,1-4H3
SMILES:CS(=O)(=O)OCC(COS(=O)(=O)C)(COS(=O)(=O)C)COS(=O)(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Tetramesylate
CAS:Tetramesylate is a molecule with cavity. It has a homochiral trehalose, which is a sugar that is used as energy storage in many organisms. The sulphonate group on the molecule is positioned to bind with metal ions and form insoluble compounds. The benzoate group on the molecule can be synthesized from sodium sulfide and glycosidic bond. Tetramesylate's x-ray structures have been solved by determining the binding of glycosidic bond to metal ions. This molecular structure also has a nucleophilic center that can react with an electrophile or nucleophile.
Formula:C9H20O12S4Purity:Min. 95%Color and Shape:PowderMolecular weight:448.51 g/mol
