CAS 7511-73-1

3-[4-(3-methylphenyl)piperazin-1-yl]propan-1-ol

Description:

3-[4-(3-Methylphenyl)piperazin-1-yl]propan-1-ol, with the CAS number 7511-73-1, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered ring containing two nitrogen atoms, and is substituted with a 3-methylphenyl group and a propanol chain. The presence of the hydroxyl (-OH) group in the propanol moiety contributes to its potential as a polar compound, influencing its solubility and reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Its structural characteristics suggest that it could interact with various receptors in the central nervous system. Additionally, the compound's molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₄H₂₂N₂O

InChI: InChI=1/C14H22N2O/c1-13-4-2-5-14(12-13)16-9-7-15(8-10-16)6-3-11-17/h2,4-5,12,17H,3,6-11H2,1H3