CAS 75117-30-5
:1,1-Bis(1,1-dimethylethyl) 3-ethyl 3-(formylamino)-1,1,3-propanetricarboxylate
Description:
1,1-Bis(1,1-dimethylethyl) 3-ethyl 3-(formylamino)-1,1,3-propanetricarboxylate, identified by its CAS number 75117-30-5, is a complex organic compound characterized by its multi-functional structure. It features multiple carboxylate groups, which contribute to its potential as a versatile reagent in organic synthesis. The presence of the formylamino group suggests reactivity that may facilitate further chemical transformations, making it useful in various synthetic applications. The bulky tert-butyl groups enhance its steric properties, potentially influencing its solubility and reactivity in different solvents. This compound may exhibit interesting biological activities, although specific biological data may vary. Its stability and reactivity profile would depend on the conditions under which it is handled, including temperature and pH. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment. Overall, this compound's unique structure positions it as a candidate for further research in both synthetic and applied chemistry contexts.
Formula:C17H29NO7
InChI:InChI=1S/C17H29NO7/c1-8-23-15(22)12(18-10-19)9-11(13(20)24-16(2,3)4)14(21)25-17(5,6)7/h10-12H,8-9H2,1-7H3,(H,18,19)
InChI key:InChIKey=KFHAYIBPFYQHFZ-UHFFFAOYSA-N
SMILES:C(CC(C(OCC)=O)NC=O)(C(OC(C)(C)C)=O)C(OC(C)(C)C)=O
Synonyms:- 1,1,3-Propanetricarboxylic acid, 3-(formylamino)-, 1,1-bis(1,1-dimethylethyl) 3-ethyl ester
- 1,1-Bis(1,1-dimethylethyl) 3-ethyl 3-(formylamino)-1,1,3-propanetricarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
