CymitQuimica logo

CAS 7512-38-1

:

[4-[bis(2-hydroxy-6-isopropyl-3-methyl-phenyl)methylene]-1-cyclohexa-2,5-dienylidene]-dimethyl-ammonium; sulfuric acid

Description:
The chemical substance with the name "[4-[bis(2-hydroxy-6-isopropyl-3-methyl-phenyl)methylene]-1-cyclohexa-2,5-dienylidene]-dimethyl-ammonium; sulfuric acid" and CAS number 7512-38-1 is a complex organic compound that features a quaternary ammonium structure. It is characterized by the presence of a dimethylammonium group, which imparts cationic properties, and a bisphenolic moiety that contributes to its potential applications in various fields, including dyes and pigments. The compound is likely to exhibit solubility in polar solvents due to the presence of hydroxyl groups, while its aromatic rings may provide stability and contribute to its color properties. The addition of sulfuric acid suggests that the compound may exist in a protonated form, enhancing its reactivity and solubility in aqueous environments. Overall, this substance may be utilized in applications such as textile dyeing, as a surfactant, or in other chemical processes where cationic agents are beneficial. However, specific safety and handling guidelines should be followed due to its complex nature and potential hazards.
Formula:C29H38NO6S
InChI:InChI=1/C29H35NO2.H2O4S/c1-17(2)23-15-9-19(5)28(31)26(23)25(21-11-13-22(14-12-21)30(7)8)27-24(18(3)4)16-10-20(6)29(27)32;1-5(2,3)4/h9-18H,1-8H3,(H,31,32);(H2,1,2,3,4)/p+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.