
CAS 75139-38-7
:Carbazomycin B
Description:
Carbazomycin B is a naturally occurring antibiotic compound belonging to the class of carbapenems, which are known for their broad-spectrum antibacterial activity. It is produced by certain strains of the bacterium *Streptomyces* and exhibits significant efficacy against various Gram-positive and Gram-negative bacteria. The molecular structure of Carbazomycin B features a complex bicyclic core that contributes to its biological activity. It is characterized by its ability to inhibit bacterial cell wall synthesis, making it effective in treating infections caused by resistant bacterial strains. Additionally, Carbazomycin B has been studied for its potential applications in pharmaceutical development due to its unique mechanism of action and structural properties. Its CAS number, 75139-38-7, is a unique identifier that facilitates the cataloging and research of this compound in scientific literature and databases. Overall, Carbazomycin B represents a valuable compound in the field of medicinal chemistry and antibiotic research.
Formula:C15H15NO2
InChI:InChI=1S/C15H15NO2/c1-8-9(2)15(18-3)14(17)12-10-6-4-5-7-11(10)16-13(8)12/h4-7,16-17H,1-3H3
InChI key:InChIKey=OBMFXFPFPDTBHG-UHFFFAOYSA-N
SMILES:OC1=C2C(NC=3C2=CC=CC3)=C(C)C(C)=C1OC
Synonyms:- 3-Methoxy-1,2-dimethyl-9H-carbazol-4-ol
- Carbazomycin B
- 9H-Carbazol-4-ol, 3-methoxy-1,2-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Carbazomycin B
CAS:Carbazomycin B is a bioactive compound which is an antibiotic derived from the soil bacterium Streptomyces. This compound exhibits its mode of action by interfering with the synthesis of bacterial cell walls, which ultimately restricts the growth and proliferation of bacterial cells. The unique chemical structure of Carbazomycin B allows it to target specific pathways within bacterial organisms, making it an important tool in combating resistant strains.
Formula:C15H15NO2Purity:Min. 95%Molecular weight:241.28 g/molCarbazomycin B
CAS:Carbazomycin B, a Streptomyces metabolite, combats fungi, bacteria, P. falciparum, C. albicans, and some cancer cells; inhibits 5-LO (IC50=1.5µM).Formula:C15H15NO2Color and Shape:SolidMolecular weight:241.29

