CymitQuimica logo

CAS 75140-34-0

:

2-Amino-1-(4-pyridinyl)ethanone

Description:
2-Amino-1-(4-pyridinyl)ethanone, also known as 4-Pyridinylacetone, is an organic compound characterized by the presence of an amino group and a pyridine ring. Its molecular structure features a ketone functional group adjacent to an amino group, which contributes to its reactivity and potential biological activity. The compound is typically a solid at room temperature and is soluble in polar solvents due to its ability to form hydrogen bonds. It may exhibit basic properties due to the nitrogen atom in the pyridine ring, which can participate in protonation reactions. This compound is of interest in medicinal chemistry and may serve as a building block for the synthesis of various pharmaceuticals. Its derivatives could potentially exhibit antimicrobial or anti-inflammatory properties, making it a subject of research in drug development. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C7H8N2O
InChI:InChI=1S/C7H8N2O/c8-5-7(10)6-1-3-9-4-2-6/h1-4H,5,8H2
InChI key:InChIKey=SVJIQXGHQJABJI-UHFFFAOYSA-N
SMILES:C(CN)(=O)C=1C=CN=CC1
Synonyms:
  • 2-Amino-1-(pyridin-4-yl)ethan-1-one
  • 2-Amino-1-(4-pyridinyl)ethanone
  • Ethanone, 2-amino-1-(4-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.