CymitQuimica logo

CAS 751469-07-5

:

rel-(3R,4S)-3-Aminodihydro-4-hydroxy-2(3H)-furanone

Description:
Rel-(3R,4S)-3-Aminodihydro-4-hydroxy-2(3H)-furanone, with the CAS number 751469-07-5, is a chemical compound characterized by its furanone structure, which features a five-membered lactone ring containing both oxygen and carbon atoms. This compound exhibits chirality, indicated by its specific stereochemical configuration at the 3 and 4 positions, which can influence its biological activity and interactions. The presence of an amino group and a hydroxyl group contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. The compound may participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, due to the reactivity of its functional groups. Additionally, its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental conditions such as pH and temperature.
Formula:C4H7NO3
InChI:InChI=1/C4H7NO3/c5-3-2(6)1-8-4(3)7/h2-3,6H,1,5H2/t2-,3-/s2
InChI key:InChIKey=JWYJRISKBFDBGT-MZTXYVAJNA-N
SMILES:N[C@@H]1[C@H](O)COC1=O
Synonyms:
  • rel-(3R,4S)-3-Aminodihydro-4-hydroxy-2(3H)-furanone
  • 2(3H)-Furanone, 3-aminodihydro-4-hydroxy-, (3R,4S)-rel-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.