CAS 751479-66-0
:ethyl 5-(aminomethyl)-1,3,4-oxadiazole-2-carboxylate; 2,2,2-trifluoroacetic acid
Description:
Ethyl 5-(aminomethyl)-1,3,4-oxadiazole-2-carboxylate, also known as 2,2,2-trifluoroacetic acid, is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the aminomethyl group enhances its reactivity and may facilitate interactions with biological targets. The ethyl ester group provides lipophilicity, which can influence its solubility and permeability in biological systems. The trifluoroacetic acid moiety is notable for its strong acidity and ability to form stable salts, which can be advantageous in various chemical reactions and applications. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Additionally, its stability under various conditions and potential for modification make it a versatile candidate for further chemical synthesis and exploration in medicinal chemistry. Overall, the combination of functional groups and structural features positions this compound as a significant entity in the field of organic and medicinal chemistry.
Formula:C8H10F3N3O5
InChI:InChI=1/C6H9N3O3.C2HF3O2/c1-2-11-6(10)5-9-8-4(3-7)12-5;3-2(4,5)1(6)7/h2-3,7H2,1H3;(H,6,7)
SMILES:CCOC(=O)c1nnc(CN)o1.C(=O)(C(F)(F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 5-(aminomethyl)-1,3,4-oxadiazol-2-carboxylate trifluoroacetic acid
CAS:Formula:C6H9N3O3Molecular weight:171.1540
