CymitQuimica logo

CAS 7515-18-6

:

2-Propynoic acid, 3-(4-chlorophenyl)-, methyl ester

Description:
2-Propynoic acid, 3-(4-chlorophenyl)-, methyl ester, also known as methyl 3-(4-chlorophenyl)prop-2-ynoate, is an organic compound characterized by its ester functional group and a propyne moiety. It features a propynoic acid backbone with a methyl ester at one end and a para-chlorophenyl group at the third carbon. This compound is typically a colorless to pale yellow liquid with a distinct odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic ring. The presence of the chlorophenyl group can impart unique chemical reactivity, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. The compound may exhibit biological activity, and its derivatives are often explored for potential therapeutic uses. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Proper storage and disposal methods are essential to minimize environmental impact.
Formula:C10H7ClO2
InChI:InChI=1S/C10H7ClO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-3,5-6H,1H3
InChI key:VAAXQAIHXHGPPC-UHFFFAOYSA-N
SMILES:COC(=O)C#CC1=CC=C(C=C1)Cl
Found 5 products.