CAS 7515-73-3
:4-(chlorophenylmethyl)-1,1'-biphenyl
Description:
4-(Chlorophenylmethyl)-1,1'-biphenyl, with the CAS number 7515-73-3, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorophenylmethyl group indicates that one of the phenyl rings is substituted with a chlorophenyl group, enhancing its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential uses in various chemical syntheses, particularly in the development of pharmaceuticals or agrochemicals. The chlorinated substituent can influence the compound's electronic properties, making it of interest in materials science and organic electronics. Additionally, the compound's stability and reactivity can be affected by environmental factors, which is important for assessing its safety and handling in laboratory settings. As with many organic compounds, proper safety precautions should be taken when handling this substance due to potential toxicity and environmental impact.
Formula:C19H15Cl
InChI:InChI=1/C19H15Cl/c20-19(17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14,19H
InChI key:InChIKey=HSVIAUJGCMPSQO-UHFFFAOYSA-N
SMILES:C(Cl)(C1=CC=C(C=C1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Biphenyl, 4-(α-chlorobenzyl)-
- 4-(Chlorophenylmethyl)-1,1′-biphenyl
- 1,1′-Biphenyl, 4-(chlorophenylmethyl)-
- 1,1′-Biphenyl, 4-(chlorophenylmethyl)-, (±)-
- 4-Biphenylylchlorophenylmethane
- 4-(A-CHLOROBENZYL)BIPHENYL
- 4-(-Chlorobenzyl)biphenyl
- 4-(Bisphenyl)chlorophenylmethane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Biphenylylchlorophenylmethane
CAS:Controlled ProductFormula:C19H15ClColor and Shape:NeatMolecular weight:278.78
