CAS 7516-33-8

4-Piperidinone, 1,2,5-trimethyl-

Description:

4-Piperidinone, 1,2,5-trimethyl- (CAS 7516-33-8) is a cyclic amine characterized by a piperidinone structure, which includes a six-membered ring containing one nitrogen atom and a carbonyl group. This compound features three methyl groups attached to the piperidine ring, specifically at the 1, 2, and 5 positions, which influence its physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the carbonyl group contributes to its reactivity, making it a potential intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit basic properties due to the nitrogen atom in the ring, allowing it to participate in various chemical reactions, including nucleophilic attacks. Its solubility in organic solvents and moderate stability under standard conditions make it useful in various applications, although safety precautions should be taken due to potential toxicity and reactivity.

Formula: C₈H₁₅NO

InChI: InChI=1S/C8H15NO/c1-6-5-9(3)7(2)4-8(6)10/h6-7H,4-5H2,1-3H3

InChI key: InChIKey=VQHHMWWQNKUPKH-UHFFFAOYSA-N

SMILES: CC1C(=O)CC(C)N(C)C1

Synonyms:

• 1,2,5-Trimethyl-4-ketopiperidine
• 1,2,5-Trimethyl-4-piperidone
• 1,2,5-trimethyl-4-Piperidinone
• 4-Piperidone, 1,2,5-trimethyl-

1,2,5-Trimethylpiperidin-4-one

CAS: 7516-33-8

Formula: C₈H₁₅NO

Molecular weight: 141.2108

Ref: IN-DA008NTZ

1,2,5-Trimethylpiperidin-4-one

CAS: 7516-33-8

1,2,5-Trimethylpiperidin-4-one is an active substance that belongs to the class of benzofuran derivatives. It has been shown to be a potent inhibitor of the enzyme oxalate oxidase and has been used in the synthesis of analogs. The tautomeric form of 1,2,5-trimethylpiperidin-4-one is its enol form with an oxime group on the alpha carbon atom. This molecule can react with ethyl bromoacetate in a condensation reaction to produce an amide derivative.

Formula: C₈H₁₅NO

Purity: Min. 95%

Molecular weight: 141.21 g/mol

Ref: 3D-HAA51633