CAS 75166-64-2
:3-Amino-2-nonanol
Description:
3-Amino-2-nonanol, with the CAS number 75166-64-2, is an organic compound characterized by the presence of both an amino group (-NH2) and a hydroxyl group (-OH) within its molecular structure. This compound features a nonane backbone, indicating it is a nine-carbon straight-chain alcohol. The amino group is located at the third carbon, while the hydroxyl group is attached to the second carbon, contributing to its classification as an amino alcohol. 3-Amino-2-nonanol is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in water due to the presence of the hydroxyl group. Its functional groups allow it to participate in various chemical reactions, making it useful in organic synthesis and as a potential intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Proper handling and safety measures should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H21NO
InChI:InChI=1S/C9H21NO/c1-3-4-5-6-7-9(10)8(2)11/h8-9,11H,3-7,10H2,1-2H3
InChI key:InChIKey=SKURPTBUALFOED-UHFFFAOYSA-N
SMILES:C(CCCCCC)(C(C)O)N
Synonyms:- 2-Nonanol, 3-amino-
- 3-Aminononan-2-ol
- 3-Amino-2-nonanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
