CymitQuimica logo

CAS 75166-65-3

:

3-[(5-amino-6-chloropyrimidin-4-yl)amino]nonan-2-ol

Description:
3-[(5-amino-6-chloropyrimidin-4-yl)amino]nonan-2-ol, with the CAS number 75166-65-3, is a chemical compound characterized by its unique structure that includes a nonan-2-ol backbone and a pyrimidine ring substituted with an amino group and a chlorine atom. This compound typically exhibits properties associated with both alcohols and amines, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the chloropyrimidine moiety suggests that it may have biological activity, potentially acting as a pharmaceutical agent or a building block in medicinal chemistry. The amino group can enhance its reactivity and interaction with biological targets, while the nonan-2-ol portion contributes to its hydrophobic characteristics. Overall, this compound may be of interest in drug development and research due to its structural features and potential applications in various fields, including biochemistry and pharmacology.
Formula:C13H23ClN4O
InChI:InChI=1/C13H23ClN4O/c1-3-4-5-6-7-10(9(2)19)18-13-11(15)12(14)16-8-17-13/h8-10,19H,3-7,15H2,1-2H3,(H,16,17,18)
SMILES:CCCCCCC(C(C)O)Nc1c(c(Cl)ncn1)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.