CymitQuimica logo

CAS 75172-66-6

:

L-4-Methoxymandelic Acid

Description:
L-4-Methoxymandelic Acid, with the CAS number 75172-66-6, is an aromatic compound characterized by the presence of a methoxy group and a carboxylic acid functional group. It is a derivative of mandelic acid, which is known for its role in various biochemical processes. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. L-4-Methoxymandelic Acid is often studied for its potential applications in pharmaceuticals and as a biochemical marker. Its structure allows for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, it may exhibit specific biological activities, although detailed studies are necessary to fully elucidate its pharmacological properties. As with many organic acids, it may participate in acid-base reactions and can act as a weak acid in solution. Proper handling and storage conditions are essential to maintain its stability and efficacy in research and application settings.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8,10H,1H3,(H,11,12)/t8-/m0/s1
InChI key:ITECRQOOEQWFPE-QMMMGPOBSA-N
SMILES:COC1=CC=C(C=C1)[C@@H](C(=O)O)O
Found 4 products.