
CAS 75175-38-1
:5-(3-Fluorophenyl)-2(1H)-pyrimidinone
Description:
5-(3-Fluorophenyl)-2(1H)-pyrimidinone, identified by its CAS number 75175-38-1, is a heterocyclic organic compound featuring a pyrimidinone core substituted with a 3-fluorophenyl group. This compound typically exhibits characteristics common to pyrimidinones, such as being a solid at room temperature and possessing a relatively high melting point. The presence of the fluorine atom in the phenyl ring can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure allows for hydrogen bonding due to the carbonyl and nitrogen functionalities, which can play a role in its interactions with biological targets. Additionally, its solubility profile may vary depending on the solvent, influenced by the fluorinated aromatic group. Overall, 5-(3-Fluorophenyl)-2(1H)-pyrimidinone is a compound of interest for further research in various chemical and biological applications.
Formula:C10H7FN2O
InChI:InChI=1S/C10H7FN2O/c11-9-3-1-2-7(4-9)8-5-12-10(14)13-6-8/h1-6H,(H,12,13,14)
InChI key:InChIKey=OMURGRVLPCSKNT-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C2=CNC(=O)N=C2
Synonyms:- 2(1H)-Pyrimidinone, 5-(3-fluorophenyl)-
- 5-(3-Fluorophenyl)-2(1H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.