CymitQuimica logo

CAS 75175-79-0

:

1-(3-Chlorophenyl)-3-(dimethylamino)-2-propen-1-one

Description:
1-(3-Chlorophenyl)-3-(dimethylamino)-2-propen-1-one, also known as a derivative of chalcone, is an organic compound characterized by its unique structure that includes a chlorophenyl group and a dimethylamino group. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the dimethylamino group enhances its solubility in organic solvents, making it useful in various chemical applications. Its reactivity is influenced by the α,β-unsaturated carbonyl system, which can participate in Michael addition reactions and other nucleophilic attacks. Additionally, the chlorophenyl moiety can affect the compound's electronic properties and reactivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its diverse potential applications.
Formula:C11H12ClNO
InChI:InChI=1S/C11H12ClNO/c1-13(2)7-6-11(14)9-4-3-5-10(12)8-9/h3-8H,1-2H3
InChI key:InChIKey=LDBZHHVGVAIVBT-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CC(Cl)=CC=C1
Synonyms:
  • 2-Propen-1-one, 1-(3-chlorophenyl)-3-(dimethylamino)-
  • 1-(3-Chlorophenyl)-3-dimethylaminopropenone
  • 1-(3-Chlorophenyl)-3-(dimethylamino)-2-propen-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.