CAS 75180-54-0

1-(2-Thienyl)cyclopentanemethanamine

Description:

1-(2-Thienyl)cyclopentanemethanamine, identified by its CAS number 75180-54-0, is an organic compound characterized by the presence of a thienyl group attached to a cyclopentanemethanamine structure. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound typically exhibits a moderate polarity due to the presence of both aliphatic and aromatic components, which can influence its solubility in various solvents. The amine functional group suggests that it may engage in hydrogen bonding, affecting its physical properties and reactivity. Additionally, the cyclopentane ring introduces a degree of strain and rigidity, which can impact the compound's conformational flexibility. Such characteristics may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals, where thienyl and amine functionalities are often associated with biological activity. Overall, 1-(2-Thienyl)cyclopentanemethanamine presents a unique structural framework that may be explored for various chemical applications.

Formula: C₁₀H₁₅NS

InChI: InChI=1S/C10H15NS/c11-8-10(5-1-2-6-10)9-4-3-7-12-9/h3-4,7H,1-2,5-6,8,11H2

InChI key: InChIKey=MDNIELHLGOAGCL-UHFFFAOYSA-N

SMILES: C(N)C1(CCCC1)C2=CC=CS2

Synonyms:

• (1-Thiophen-2-ylcyclopentyl)methanamine
• 1-(2-Thienyl)cyclopentanemethanamine
• Cyclopentanemethanamine, 1-(2-thienyl)-
• [1-(Thiophen-2-yl)cyclopentyl]methanamine

[1-(Thiophen-2-yl)cyclopentyl]methanamine

CAS: 75180-54-0

Versatile small molecule scaffold

Formula: C₁₀H₁₅NS

Purity: Min. 95%

Molecular weight: 181.3 g/mol

Ref: 3D-ADA18054