
CAS 7519-92-8
:Tris(3-chlorophenyl)boroxin
Description:
Tris(3-chlorophenyl)boroxin, with the CAS number 7519-92-8, is an organoboron compound characterized by its boron-oxygen framework and the presence of three 3-chlorophenyl groups. This compound typically exhibits a white to light yellow crystalline appearance. It is known for its stability under ambient conditions, although it may be sensitive to moisture, which can lead to hydrolysis. The presence of chlorine substituents on the phenyl rings can influence its reactivity and solubility in organic solvents. Tris(3-chlorophenyl)boroxin is often utilized in organic synthesis and materials science, particularly in the development of boron-containing polymers and as a reagent in various chemical reactions. Its unique structure allows for potential applications in medicinal chemistry and as a precursor for other boron-containing compounds. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C18H12B3Cl3O3
InChI:InChI=1S/C18H12B3Cl3O3/c22-16-7-1-4-13(10-16)19-25-20(14-5-2-8-17(23)11-14)27-21(26-19)15-6-3-9-18(24)12-15/h1-12H
InChI key:InChIKey=DCTBSOZQJIBCFX-UHFFFAOYSA-N
SMILES:ClC=1C=C(B2OB(OB(O2)C3=CC(Cl)=CC=C3)C4=CC(Cl)=CC=C4)C=CC1
Synonyms:- Boroxin, tris(3-chlorophenyl)-
- Tris(3-chlorophenyl)boroxin
- Boroxin, tris(m-chlorophenyl)-
- 2,4,6-Tris(3-chlorophenyl)boroxin
- Boroxin, 2,4,6-tris(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
