CAS 75190-82-8
:cis-10-heptadecenoic acid methyl ester
Description:
Cis-10-heptadecenoic acid methyl ester, also known as methyl cis-10-heptadecenoate, is an unsaturated fatty acid methyl ester characterized by its long carbon chain and a double bond in the cis configuration. This compound typically features a 17-carbon backbone with a double bond located between the 10th and 11th carbon atoms. The presence of the double bond imparts specific physical properties, such as lower melting points compared to saturated fatty acids of similar chain length. It is generally a colorless to pale yellow liquid at room temperature and is soluble in organic solvents. This methyl ester is often used in various applications, including as a flavoring agent, in the synthesis of surfactants, and in the production of biodiesel. Its chemical structure allows it to participate in various chemical reactions, including oxidation and polymerization. Additionally, it may exhibit biological activity, making it of interest in nutritional and pharmaceutical research. As with many fatty acid derivatives, it is important to handle it with care due to potential environmental and health impacts.
Formula:C18H34O2
InChI:InChI=1/C18H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20-2/h8-9H,3-7,10-17H2,1-2H3/b9-8-
SMILES:CCCCCC/C=C\CCCCCCCCC(=O)OC
Synonyms:- methyl (10Z)-heptadec-10-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl cis-10-heptadecenoate
CAS:Formula:C10H15NOPurity:99%Color and Shape:LiquidMolecular weight:165.2322Methyl 10(Z)-Heptadecenoate
CAS:Formula:C18H34O2Purity:>99%Color and Shape:LiquidMolecular weight:282.46cis-10-Heptadecenoic acid-methyl ester
CAS:Formula:C18H34O2Color and Shape:NeatMolecular weight:282.46(10Z)-10-Heptadecenoic Acid Methyl Ester-d3
CAS:Controlled ProductFormula:C18H31D3O2Color and Shape:NeatMolecular weight:285.4910(Z)-Heptadecenoic Acid methyl ester
CAS:Methyl 10(Z)-heptadecenoate, a minor fatty acid methyl ester (FAME) component of biodiesel, is the ester derivative of cis-10-heptadecenoic acid.Formula:C18H34O2Color and Shape:SolidMolecular weight:282.468





