CAS 75195-76-5
:Pyridine, 3-[(2S)-1-nitroso-2-pyrrolidinyl]-, 1-oxide
Description:
Pyridine, 3-[(2S)-1-nitroso-2-pyrrolidinyl]-, 1-oxide, with CAS number 75195-76-5, is a nitrogen-containing heterocyclic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring with one nitrogen atom. This compound features a nitroso group (-NO) and a pyrrolidine moiety, indicating it has both basic and potentially reactive properties. The presence of the nitroso group suggests that it may participate in various chemical reactions, including those involving electrophilic or nucleophilic interactions. As an oxide, it may also exhibit properties related to oxidation states. Pyridine derivatives are often used in organic synthesis, pharmaceuticals, and agrochemicals due to their ability to act as ligands or intermediates. The specific stereochemistry indicated by the (2S) designation suggests that the compound has a defined spatial arrangement, which can influence its reactivity and biological activity. Overall, this compound's unique structure and functional groups contribute to its potential applications in various chemical and biological contexts.
Formula:C9H11N3O2
InChI:InChI=1S/C9H11N3O2/c13-10-12-6-2-4-9(12)8-3-1-5-11(14)7-8/h1,3,5,7,9H,2,4,6H2/t9-/m0/s1
InChI key:InChIKey=ZQELURDMDMQXQV-VIFPVBQESA-N
SMILES:N(=O)N1[C@@H](CCC1)C2=CN(=O)=CC=C2
Synonyms:- 3-[(2S)-1-Nitrosopyrrolidin-2-yl]pyridin-1-ium-1-olate
- N′-Nitrosonornicotine-1-N-oxide
- Pyridine, 3-(1-nitroso-2-pyrrolidinyl)-, 1-oxide, (S)-
- Pyridine, 3-[(2S)-1-nitroso-2-pyrrolidinyl]-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.

