CAS 7520-70-9
:α-(Dimethoxymethyl)-3,4,5-trimethoxybenzenepropanenitrile
Description:
α-(Dimethoxymethyl)-3,4,5-trimethoxybenzenepropanenitrile, with the CAS number 7520-70-9, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with multiple methoxy groups and a propanenitrile functional group. The presence of three methoxy groups on the benzene ring enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The propanenitrile moiety introduces a nitrile functional group, which is known for its polar character and potential for participating in nucleophilic reactions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the dimethoxymethyl group contributes to its overall stability and may affect its electronic properties. Overall, the unique combination of functional groups in α-(Dimethoxymethyl)-3,4,5-trimethoxybenzenepropanenitrile suggests potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C15H21NO5
InChI:InChI=1S/C15H21NO5/c1-17-12-7-10(8-13(18-2)14(12)19-3)6-11(9-16)15(20-4)21-5/h7-8,11,15H,6H2,1-5H3
InChI key:InChIKey=YJLVEDBQYCETMX-UHFFFAOYSA-N
SMILES:C(C(C(OC)OC)C#N)C1=CC(OC)=C(OC)C(OC)=C1
Synonyms:- 2-(Dimethoxymethyl)-3-(3,4,5-trimethoxyphenyl)propanenitrile
- Benzenepropanenitrile, α-(dimethoxymethyl)-3,4,5-trimethoxy-
- Hydrocinnamaldehyde, α-cyano-3,4,5-trimethoxy-, dimethyl acetal
- α-(Dimethoxymethyl)-3,4,5-trimethoxybenzenepropanenitrile
- Malonaldehydonitrile, (3,4,5-trimethoxybenzyl)-, dimethyl acetal
- α-Cyano-3,4,5-triMethoxy-hydrocinnaMaldehyde DiMethyl Acetal
- α-(DiMethoxyMethyl)-3,4,5-triMethoxy-benzenepropanenitrile
- 3,4,5-TRIMETHOXY-2'-CYANO-DI-HYDROCINNAMALDEHYDE DIMETHYLACETAL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.