CymitQuimica logo

CAS 7520-95-8

:

2-bromo-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone

Description:
2-Bromo-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone is an organic compound characterized by its complex structure, which includes a bromine atom, a thiazole ring, and a ketone functional group. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. This compound typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the reactive nature of the bromine and the carbonyl group. Additionally, the compound's unique arrangement of functional groups may impart specific optical and electronic properties, making it of interest in materials science and medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-bromo-1-(4-methyl-2-phenyl-1,3-thiazol-5-yl)ethanone is a noteworthy compound in organic synthesis and research.
Formula:C12H10BrNOS
InChI:InChI=1/C12H10BrNOS/c1-8-11(10(15)7-13)16-12(14-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3
SMILES:Cc1c(C(=O)CBr)sc(c2ccccc2)n1
Synonyms:
  • 2-Bromo-1-(4-Methyl-2-Phenyl-1,3-Thiazol-5-Yl)-1-Ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.