CAS 75207-54-4
:pentacosan-2-one
Description:
Pentacosan-2-one, with the CAS number 75207-54-4, is a long-chain aliphatic ketone characterized by a 25-carbon backbone with a ketone functional group located at the second carbon position. This compound is part of the larger family of ketones, which are known for their carbonyl group (C=O) that significantly influences their chemical properties. Pentacosan-2-one is typically a colorless to pale yellow liquid or solid, depending on temperature, and exhibits a waxy texture. It is relatively insoluble in water due to its long hydrophobic carbon chain but is soluble in organic solvents. The presence of the ketone group allows for potential reactivity in various chemical reactions, including oxidation and reduction processes. Pentacosan-2-one may also exhibit interesting physical properties such as a high boiling point and low volatility, making it useful in applications such as fragrances, flavoring agents, or as a potential intermediate in organic synthesis. Its long carbon chain contributes to its hydrophobic nature, influencing its behavior in biological and environmental systems.
Formula:C25H50O
InChI:InChI=1/C25H50O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(2)26/h3-24H2,1-2H3
SMILES:CCCCCCCCCCCCCCCCCCCCCCCC(=O)C
Synonyms:- 2-Pentacosanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Pentacosanone
CAS:2-Pentacosanone is a useful scaffold for the synthesis of complex compounds. It is also used as a building block in organic chemistry and as an intermediate in the synthesis of other chemicals. 2-Pentacosanone is a speciality chemical that can be used as a reaction component or reagent. 2-Pentacosanone has CAS number 75207-54-4, which can be used to identify it.
Formula:C25H50OPurity:Min. 95%Color and Shape:PowderMolecular weight:366.66 g/mol




