CAS 75207-77-1
:2,3,4,5-tetrafluoro-8$l^{4}-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaene
Description:
2,3,4,5-Tetrafluoro-8$l^{4}-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaene, with CAS number 75207-77-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates both sulfur and nitrogen atoms. The presence of four fluorine atoms contributes to its high electronegativity and alters its chemical reactivity, making it potentially useful in various applications, including pharmaceuticals and materials science. The bicyclic framework suggests that the compound may exhibit interesting stereochemical properties and could participate in specific types of chemical reactions, such as nucleophilic substitutions or cycloadditions. Additionally, the presence of multiple double bonds in the pentaene structure indicates that it may have significant conjugation, which can influence its optical properties and stability. Overall, this compound's unique structural features and functional groups make it a subject of interest for further research in synthetic chemistry and potential applications in advanced materials.
Formula:C6F4N2S
InChI:InChI=1/C6F4N2S/c7-1-2(8)4(10)6-5(3(1)9)11-13-12-6
SMILES:c1(c(c(c2c(c1F)nsn2)F)F)F
Synonyms:- 2,1,3-Benzothiadiazole, tetrafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.