CAS 7521-27-9
:2-(3-Pyridinyl)pyrido[2,3-d]pyrimidine
Description:
2-(3-Pyridinyl)pyrido[2,3-d]pyrimidine, with the CAS number 7521-27-9, is a heterocyclic compound that features a fused bicyclic structure comprising pyridine and pyrimidine rings. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. It typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents. The presence of the pyridine moiety enhances its ability to participate in coordination chemistry and may influence its biological activity. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly as a scaffold for designing kinase inhibitors or other therapeutic agents. Its unique structural features allow for various substitutions, which can modulate its pharmacological properties. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system of the aromatic rings, making it a subject of study in materials science and organic electronics. Overall, 2-(3-Pyridinyl)pyrido[2,3-d]pyrimidine represents a versatile structure with potential applications across multiple fields.
Formula:C12H8N4
InChI:InChI=1S/C12H8N4/c1-3-9(7-13-5-1)12-15-8-10-4-2-6-14-11(10)16-12/h1-8H
InChI key:InChIKey=MKJGBTYCQKYWMA-UHFFFAOYSA-N
SMILES:C1(=NC2=C(C=N1)C=CC=N2)C=3C=CC=NC3
Synonyms:- 2-(3-Pyridinyl)pyrido[2,3-d]pyrimidine
- Pyrido[2,3-d]pyrimidine, 2-(3-pyridyl)-
- Pyrido[2,3-d]pyrimidine, 2-(3-pyridinyl)-
- 2-(3-Pyridyl)-1,3,8-triazanaphthalene
- NSC 659121
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(pyridin-3-yl)pyrido[2,3-d]pyrimidine
CAS:Controlled ProductApplications 2-(pyridin-3-yl)pyrido[2,3-d]pyrimidine has been used in the preparation of divalent transition metal aminonicotinaldehyde chloride complexes, antimicrobial, antioxidant and antitumor activities, electrochemical and molecular docking with EGFR protein.
References Konakanchi R., et al., Res. Chem. Intermed., 44, 27-53 (2018)Formula:C12H8N4Color and Shape:NeatMolecular weight:208.219

