CAS 7521-79-1
:2-(3-methylbutoxy)ethanol
Description:
2-(3-Methylbutoxy)ethanol, with the CAS number 7521-79-1, is an organic compound characterized by its ether and alcohol functional groups. It features a 3-methylbutyl group attached to an ethylene glycol moiety, which contributes to its solubility in both polar and non-polar solvents. This compound is typically a colorless liquid with a mild odor, and it is known for its moderate volatility and relatively low toxicity compared to other solvents. It has applications in various industries, including as a solvent in paints, coatings, and cleaning products, due to its ability to dissolve a wide range of substances. Additionally, it exhibits good wetting properties, making it useful in formulations that require enhanced surface interaction. The compound's physical properties, such as boiling point and density, can vary based on environmental conditions and purity levels. As with many organic solvents, proper handling and safety precautions are essential to mitigate any potential health risks associated with exposure.
Formula:C7H16O2
InChI:InChI=1/C7H16O2/c1-7(2)3-5-9-6-4-8/h7-8H,3-6H2,1-2H3
SMILES:CC(C)CCOCCO
Synonyms:- 2-Isopentoxyethanol
- Ethanol, 2-(3-Methylbutoxy)-
- 2-(3-Methylbutoxy)ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(3-Methylbutoxy)ethan-1-ol
CAS:2-(3-Methylbutoxy)ethan-1-ol is an organic solvent that is used as a raw material in the production of activated carbon. It is also used as a base for the neutralization of acids, and can be converted to other compounds such as ethylene glycol. 2-(3-Methylbutoxy)ethan-1-ol has a viscosity of 1.5 cP at 20 °C and a density of 0.898 g/cm³, and can be used in the production of solar cells. This chemical can be synthesized from ethanol by catalytic hydrogenation or hydroformylation using molybdenum oxide or rhodium oxide on phosphoric acid.Formula:C7H16O2Purity:Min. 95%Molecular weight:132.2 g/mol
