CAS 75214-12-9

methyl 3-amino-4-[(1-benzyl-2-methoxy-2-oxoethyl)amino]-4-oxobutanoate hydrochloride

Description:

Methyl 3-amino-4-[(1-benzyl-2-methoxy-2-oxoethyl)amino]-4-oxobutanoate hydrochloride, with the CAS number 75214-12-9, is a synthetic organic compound characterized by its complex structure, which includes an amino acid derivative and a benzyl group. This compound typically appears as a white to off-white crystalline powder and is soluble in water and organic solvents, reflecting its polar functional groups. The presence of the amino and carbonyl groups suggests potential reactivity, making it useful in various chemical reactions, including peptide synthesis and medicinal chemistry. Its hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in biological systems. The compound may exhibit biological activity, potentially serving as a lead compound in drug development, particularly in the fields of anti-inflammatory or anticancer research. As with many synthetic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₂₁ClN₂O₅

InChI: InChI=1/C15H20N2O5.ClH/c1-21-13(18)9-11(16)14(19)17-12(15(20)22-2)8-10-6-4-3-5-7-10;/h3-7,11-12H,8-9,16H2,1-2H3,(H,17,19);1H/t11-,12+;/m0./s1

Synonyms:

• methyl (3S)-3-amino-4-{[(1R)-1-benzyl-2-methoxy-2-oxoethyl]amino}-4-oxobutanoate hydrochloride (non-preferred name)

methyl 3-amino-4-[(1-benzyl-2-methoxy-2-oxoethyl)amino]-4-oxobutanoate hydrochloride

CAS: 75214-12-9

methyl 3-amino-4-[(1-benzyl-2-methoxy-2-oxoethyl)amino]-4-oxobutanoate hydrochloride

Purity: ≥95%

Molecular weight: 344.79g/mol

Ref: 54-OR26836