CAS 752154-64-6
:N-[(2S,3R)-1-benzyl-2-methylpyrrolidin-3-yl]-5-chloro-2-methoxy-4-(methylamino)benzamide
Description:
N-[(2S,3R)-1-benzyl-2-methylpyrrolidin-3-yl]-5-chloro-2-methoxy-4-(methylamino)benzamide is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring, a benzyl group, and various functional groups such as a chloro, methoxy, and methylamino substituents. This compound is typically classified as a small organic molecule and may exhibit properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features. The presence of the benzamide moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its stereochemistry, indicated by the (2S,3R) configuration, may influence its pharmacological properties and interactions with receptors or enzymes. The compound's CAS number, 752154-64-6, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and development. Overall, this compound's unique characteristics make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C21H26ClN3O2
InChI:InChI=1/C21H26ClN3O2/c1-14-18(9-10-25(14)13-15-7-5-4-6-8-15)24-21(26)16-11-17(22)19(23-2)12-20(16)27-3/h4-8,11-12,14,18,23H,9-10,13H2,1-3H3,(H,24,26)/t14-,18+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
trans-Nemonapride
CAS:trans-Nemonapride is a chemical compound with a CAS number of 752154-64-6. It is an intermediate used in the synthesis of other chemicals, such as research chemicals and speciality chemicals. trans-Nemonapride's versatility makes it useful for complex chemical reactions, and its high quality makes it an ideal reagent for many reactions.
Formula:C21H26ClN3O2Purity:Min. 95%Color and Shape:Yellow To Brown SolidMolecular weight:387.9 g/moltrans-Nemonapride
CAS:Controlled ProductApplications trans-Nemonapride is a selective dopamine D2 receptor antagonist. trans-Nemonapride is used as an antipsychotic.
References Yamamoto, M., et al.: Neuropharmacology, 21, 945 (1982), Grewe, C.W., et al.: Eur. J. Pharmacol., 81, 149 (1982), Satoh, K., et al.: Int. Clin. Psychopharmacol., 11, 279 (1996)Formula:C21H26ClN3O2Color and Shape:NeatMolecular weight:387.9


