CAS 752183-00-9
:6-(bromomethyl)isoquinoline
Description:
6-(Bromomethyl)isoquinoline is a chemical compound characterized by its isoquinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of a bromomethyl group at the 6-position of the isoquinoline structure introduces a bromine atom attached to a methylene (-CH2-) group, enhancing its reactivity and potential for further chemical modifications. This compound is typically used in organic synthesis and medicinal chemistry, where it may serve as an intermediate for the development of pharmaceuticals or other bioactive molecules. Its properties include being a solid at room temperature, with potential solubility in organic solvents. The bromomethyl group can participate in nucleophilic substitution reactions, making it a versatile building block in synthetic chemistry. Additionally, the isoquinoline moiety may exhibit biological activity, contributing to the compound's relevance in drug discovery and development. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c11-6-8-1-2-10-7-12-4-3-9(10)5-8/h1-5,7H,6H2
SMILES:c1cc2cnccc2cc1CBr
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
