CAS 75220-48-3

(5R)-N-(4-chlorophenyl)-5-methyl-4,5-dihydro-1,3-thiazol-2-amine

Description:

(5R)-N-(4-chlorophenyl)-5-methyl-4,5-dihydro-1,3-thiazol-2-amine, with the CAS number 75220-48-3, is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. This compound features a chiral center, indicated by the (5R) designation, which contributes to its stereochemistry and potential biological activity. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The methyl group at the 5-position of the thiazole ring can affect the compound's reactivity and solubility. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in various chemical environments.

Formula: C₁₀H₁₁ClN₂S

InChI: InChI=1/C10H11ClN2S/c1-7-6-12-10(14-7)13-9-4-2-8(11)3-5-9/h2-5,7H,6H2,1H3,(H,12,13)/t7-/m1/s1

SMILES: C[C@@H]1CN=C(Nc2ccc(cc2)Cl)S1

N-(4-Chlorophenyl)-5-methyl-4,5-dihydro-1,3-thiazol-2-amine

CAS: 75220-48-3

Versatile small molecule scaffold

Formula: C₁₀H₁₁ClN₂S

Purity: Min. 95%

Molecular weight: 226.73 g/mol

Ref: 3D-ADA22048