CymitQuimica logo

CAS 752231-43-9

:

ethyl 2-chloro-5-(5-formylfuran-2-yl)benzoate

Description:
Ethyl 2-chloro-5-(5-formylfuran-2-yl)benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety, a chloro substituent, and a furan ring with an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the aldehyde group. The chloro substituent can influence its reactivity, making it a candidate for nucleophilic substitution reactions. The furan ring contributes to the compound's aromaticity and may also participate in various chemical reactions, including electrophilic aromatic substitution. Ethyl 2-chloro-5-(5-formylfuran-2-yl)benzoate may find applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features that allow for further functionalization. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C14H11ClO4
InChI:InChI=1/C14H11ClO4/c1-2-18-14(17)11-7-9(3-5-12(11)15)13-6-4-10(8-16)19-13/h3-8H,2H2,1H3
SMILES:CCOC(=O)c1cc(ccc1Cl)c1ccc(C=O)o1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.