CymitQuimica logo

CAS 752241-92-2

:

4-({[tert-butyl(dimethyl)silyl]oxy}methyl)-1,3-thiazol-2-amine

Description:
4-({[tert-butyl(dimethyl)silyl]oxy}methyl)-1,3-thiazol-2-amine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of the tert-butyl(dimethyl)silyl group indicates that the compound has a silyl ether functionality, which can enhance its stability and solubility in organic solvents. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and interactions in various chemical environments. The thiazole moiety may also impart biological activity, making it of interest in pharmaceutical research. Additionally, the presence of bulky silyl groups can affect the steric hindrance and electronic properties of the molecule, potentially impacting its reactivity and applications in synthetic chemistry. Overall, this compound's unique structure suggests it may have specialized uses in organic synthesis or as a potential lead in drug development.
Formula:C10H20N2OSSi
InChI:InChI=1/C10H20N2OSSi/c1-10(2,3)15(4,5)13-6-8-7-14-9(11)12-8/h7H,6H2,1-5H3,(H2,11,12)
SMILES:CC(C)(C)[Si](C)(C)OCc1csc(=N)[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.