CAS 752258-16-5

(2S)-2-(hydroxymethyl)hexanoic acid

Description:

(2S)-2-(hydroxymethyl)hexanoic acid, identified by its CAS number 752258-16-5, is an organic compound characterized by its carboxylic acid functional group and a hydroxymethyl substituent on the second carbon of a hexanoic acid chain. This compound features a chiral center, which contributes to its stereochemistry, specifically the S configuration at the second carbon. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of both the hydroxymethyl and carboxylic acid groups imparts hydrophilicity, making it soluble in water and polar solvents. This compound is of interest in various fields, including pharmaceuticals and biochemistry, due to its potential applications in drug synthesis and as a building block for more complex molecules. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other functional groups in a reaction environment.

Formula: C₇H₁₄O₃

InChI: InChI=1/C7H14O3/c1-2-3-4-6(5-8)7(9)10/h6,8H,2-5H2,1H3,(H,9,10)/t6-/m0/s1

SMILES: CCCC[C@@H](CO)C(=O)O